C13H20N2O4 — CID 83039381
2-hydroxy-4-methoxy-N-[2-(2-methoxyethylamino)ethyl]benzamide (PubChem CID 83039381) has the molecular formula C13H20N2O4 and a molecular weight of 268.31 g/mol. Its IUPAC name is 2-hydroxy-4-methoxy-N-[2-(2-methoxyethylamino)ethyl]benzamide.
| Compound Name | 2-hydroxy-4-methoxy-N-[2-(2-methoxyethylamino)ethyl]benzamide |
|---|---|
| PubChem CID | 83039381 |
| Molecular Formula | C13H20N2O4 |
| Molecular Weight | 268.31 g/mol |
| Exact Mass | 268.14 |
| IUPAC Name | 2-hydroxy-4-methoxy-N-[2-(2-methoxyethylamino)ethyl]benzamide |
| SMILES | COCCNCCNC(=O)c1ccc(OC)cc1O |
| InChI | InChI=1S/C13H20N2O4/c1-18-8-7-14-5-6-15-13(17)11-4-3-10(19-2)9-12(11)16/h3-4,9,14,16H,5-8H2,1-2H3,(H,15,17) |
| InChIKey | BQFUNGZBYAPUNV-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 79.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.31 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|