C20H27NO — CID 83937212
4-(2-methyl-4-phenoxyphenyl)heptan-1-amine (PubChem CID 83937212) has the molecular formula C20H27NO and a molecular weight of 297.44 g/mol. Its IUPAC name is 4-(2-methyl-4-phenoxyphenyl)heptan-1-amine.
| Compound Name | 4-(2-methyl-4-phenoxyphenyl)heptan-1-amine |
|---|---|
| PubChem CID | 83937212 |
| Molecular Formula | C20H27NO |
| Molecular Weight | 297.44 g/mol |
| Exact Mass | 297.21 |
| IUPAC Name | 4-(2-methyl-4-phenoxyphenyl)heptan-1-amine |
| SMILES | CCCC(CCCN)c1ccc(Oc2ccccc2)cc1C |
| InChI | InChI=1S/C20H27NO/c1-3-8-17(9-7-14-21)20-13-12-19(15-16(20)2)22-18-10-5-4-6-11-18/h4-6,10-13,15,17H,3,7-9,14,21H2,1-2H3 |
| InChIKey | CEFXZXBFXXRTSF-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.44 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |