C15H24 — CID 142336118
1-heptan-4-yl-2,4-dimethylbenzene (PubChem CID 142336118) has the molecular formula C15H24 and a molecular weight of 204.36 g/mol. Its IUPAC name is 1-heptan-4-yl-2,4-dimethylbenzene.
| Compound Name | 1-heptan-4-yl-2,4-dimethylbenzene |
|---|---|
| PubChem CID | 142336118 |
| Molecular Formula | C15H24 |
| Molecular Weight | 204.36 g/mol |
| Exact Mass | 204.19 |
| IUPAC Name | 1-heptan-4-yl-2,4-dimethylbenzene |
| SMILES | CCCC(CCC)c1ccc(C)cc1C |
| InChI | InChI=1S/C15H24/c1-5-7-14(8-6-2)15-10-9-12(3)11-13(15)4/h9-11,14H,5-8H2,1-4H3 |
| InChIKey | MMOMGAJESVIILY-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.36 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |