C11H14BNO5 — CID 174055312
4-amino-2-[(4-boronophenyl)methyl]-4-oxobutanoic acid (PubChem CID 174055312) has the molecular formula C11H14BNO5 and a molecular weight of 251.05 g/mol. Its IUPAC name is 4-amino-2-[(4-boronophenyl)methyl]-4-oxobutanoic acid.
| Compound Name | 4-amino-2-[(4-boronophenyl)methyl]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 174055312 |
| Molecular Formula | C11H14BNO5 |
| Molecular Weight | 251.05 g/mol |
| Exact Mass | 251.10 |
| IUPAC Name | 4-amino-2-[(4-boronophenyl)methyl]-4-oxobutanoic acid |
| SMILES | NC(=O)CC(Cc1ccc(B(O)O)cc1)C(=O)O |
| InChI | InChI=1S/C11H14BNO5/c13-10(14)6-8(11(15)16)5-7-1-3-9(4-2-7)12(17)18/h1-4,8,17-18H,5-6H2,(H2,13,14)(H,15,16) |
| InChIKey | KVPXAAVYCNTTRQ-UHFFFAOYSA-N |
| XLogP | -1.51 |
| TPSA | 120.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.05 |
| LogP ≤ 5 | -1.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|