C9H17N3S2 — CID 62577599
N-ethyl-4-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]butan-1-amine (PubChem CID 62577599) has the molecular formula C9H17N3S2 and a molecular weight of 231.39 g/mol. Its IUPAC name is N-ethyl-4-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]butan-1-amine.
| Compound Name | N-ethyl-4-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]butan-1-amine |
|---|---|
| PubChem CID | 62577599 |
| Molecular Formula | C9H17N3S2 |
| Molecular Weight | 231.39 g/mol |
| Exact Mass | 231.09 |
| IUPAC Name | N-ethyl-4-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]butan-1-amine |
| SMILES | CCNCCCCSc1nnc(C)s1 |
| InChI | InChI=1S/C9H17N3S2/c1-3-10-6-4-5-7-13-9-12-11-8(2)14-9/h10H,3-7H2,1-2H3 |
| InChIKey | TXLPVMUBWCPGIL-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.39 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|