C14H18N2OS3 — CID 112776296
2-[2-(2,5-dimethylphenoxy)ethylsulfanyl]-5-ethylsulfanyl-1,3,4-thiadiazole (PubChem CID 112776296) has the molecular formula C14H18N2OS3 and a molecular weight of 326.51 g/mol. Its IUPAC name is 2-[2-(2,5-dimethylphenoxy)ethylsulfanyl]-5-ethylsulfanyl-1,3,4-thiadiazole.
| Compound Name | 2-[2-(2,5-dimethylphenoxy)ethylsulfanyl]-5-ethylsulfanyl-1,3,4-thiadiazole |
|---|---|
| PubChem CID | 112776296 |
| Molecular Formula | C14H18N2OS3 |
| Molecular Weight | 326.51 g/mol |
| Exact Mass | 326.06 |
| IUPAC Name | 2-[2-(2,5-dimethylphenoxy)ethylsulfanyl]-5-ethylsulfanyl-1,3,4-thiadiazole |
| SMILES | CCSc1nnc(SCCOc2cc(C)ccc2C)s1 |
| InChI | InChI=1S/C14H18N2OS3/c1-4-18-13-15-16-14(20-13)19-8-7-17-12-9-10(2)5-6-11(12)3/h5-6,9H,4,7-8H2,1-3H3 |
| InChIKey | QPYQXOOKNCTBIQ-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.51 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|