C19H27N3OS — CID 21373808
3-cyclohexyl-5-[2-(2,5-dimethylphenoxy)ethylsulfanyl]-4-methyl-1,2,4-triazole (PubChem CID 21373808) has the molecular formula C19H27N3OS and a molecular weight of 345.51 g/mol. Its IUPAC name is 3-cyclohexyl-5-[2-(2,5-dimethylphenoxy)ethylsulfanyl]-4-methyl-1,2,4-triazole.
| Compound Name | 3-cyclohexyl-5-[2-(2,5-dimethylphenoxy)ethylsulfanyl]-4-methyl-1,2,4-triazole |
|---|---|
| PubChem CID | 21373808 |
| Molecular Formula | C19H27N3OS |
| Molecular Weight | 345.51 g/mol |
| Exact Mass | 345.19 |
| IUPAC Name | 3-cyclohexyl-5-[2-(2,5-dimethylphenoxy)ethylsulfanyl]-4-methyl-1,2,4-triazole |
| SMILES | Cc1ccc(C)c(OCCSc2nnc(C3CCCCC3)n2C)c1 |
| InChI | InChI=1S/C19H27N3OS/c1-14-9-10-15(2)17(13-14)23-11-12-24-19-21-20-18(22(19)3)16-7-5-4-6-8-16/h9-10,13,16H,4-8,11-12H2,1-3H3 |
| InChIKey | WDOMYEBWNLPDOE-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.51 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|