C17H25ClN4O2S — CID 154909145
3-[5-[2-(3-methoxyphenoxy)ethylsulfanyl]-4-methyl-1,2,4-triazol-3-yl]piperidine;hydrochloride (PubChem CID 154909145) has the molecular formula C17H25ClN4O2S and a molecular weight of 384.93 g/mol. Its IUPAC name is 3-[5-[2-(3-methoxyphenoxy)ethylsulfanyl]-4-methyl-1,2,4-triazol-3-yl]piperidine;hydrochloride.
| Compound Name | 3-[5-[2-(3-methoxyphenoxy)ethylsulfanyl]-4-methyl-1,2,4-triazol-3-yl]piperidine;hydrochloride |
|---|---|
| PubChem CID | 154909145 |
| Molecular Formula | C17H25ClN4O2S |
| Molecular Weight | 384.93 g/mol |
| Exact Mass | 384.14 |
| IUPAC Name | 3-[5-[2-(3-methoxyphenoxy)ethylsulfanyl]-4-methyl-1,2,4-triazol-3-yl]piperidine;hydrochloride |
| SMILES | COc1cccc(OCCSc2nnc(C3CCCNC3)n2C)c1.Cl |
| InChI | InChI=1S/C17H24N4O2S.ClH/c1-21-16(13-5-4-8-18-12-13)19-20-17(21)24-10-9-23-15-7-3-6-14(11-15)22-2;/h3,6-7,11,13,18H,4-5,8-10,12H2,1-2H3;1H |
| InChIKey | VNCDXEDEUZFPGL-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 61.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.93 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|