C13H23FN4S — CID 126447370
(3R)-3-[5-(5-fluoropentylsulfanyl)-4-methyl-1,2,4-triazol-3-yl]piperidine (PubChem CID 126447370) has the molecular formula C13H23FN4S and a molecular weight of 286.42 g/mol. Its IUPAC name is (3R)-3-[5-(5-fluoropentylsulfanyl)-4-methyl-1,2,4-triazol-3-yl]piperidine.
| Compound Name | (3R)-3-[5-(5-fluoropentylsulfanyl)-4-methyl-1,2,4-triazol-3-yl]piperidine |
|---|---|
| PubChem CID | 126447370 |
| Molecular Formula | C13H23FN4S |
| Molecular Weight | 286.42 g/mol |
| Exact Mass | 286.16 |
| IUPAC Name | (3R)-3-[5-(5-fluoropentylsulfanyl)-4-methyl-1,2,4-triazol-3-yl]piperidine |
| SMILES | Cn1c(SCCCCCF)nnc1[C@@H]1CCCNC1 |
| InChI | InChI=1S/C13H23FN4S/c1-18-12(11-6-5-8-15-10-11)16-17-13(18)19-9-4-2-3-7-14/h11,15H,2-10H2,1H3/t11-/m1/s1 |
| InChIKey | XUTMHTUQQPSMOJ-LLVKDONJSA-N |
| XLogP | 2.51 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.42 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|