C14H26N4OS — CID 126440803
6-[[4-methyl-5-[(3R)-piperidin-3-yl]-1,2,4-triazol-3-yl]sulfanyl]hexan-1-ol (PubChem CID 126440803) has the molecular formula C14H26N4OS and a molecular weight of 298.46 g/mol. Its IUPAC name is 6-[[4-methyl-5-[(3R)-piperidin-3-yl]-1,2,4-triazol-3-yl]sulfanyl]hexan-1-ol.
| Compound Name | 6-[[4-methyl-5-[(3R)-piperidin-3-yl]-1,2,4-triazol-3-yl]sulfanyl]hexan-1-ol |
|---|---|
| PubChem CID | 126440803 |
| Molecular Formula | C14H26N4OS |
| Molecular Weight | 298.46 g/mol |
| Exact Mass | 298.18 |
| IUPAC Name | 6-[[4-methyl-5-[(3R)-piperidin-3-yl]-1,2,4-triazol-3-yl]sulfanyl]hexan-1-ol |
| SMILES | Cn1c(SCCCCCCO)nnc1[C@@H]1CCCNC1 |
| InChI | InChI=1S/C14H26N4OS/c1-18-13(12-7-6-8-15-11-12)16-17-14(18)20-10-5-3-2-4-9-19/h12,15,19H,2-11H2,1H3/t12-/m1/s1 |
| InChIKey | QJBXIFJMVXBKOJ-GFCCVEGCSA-N |
| XLogP | 1.93 |
| TPSA | 62.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.46 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|