C14H27ClN4OS — CID 154906626
6-[(4-methyl-5-piperidin-3-yl-1,2,4-triazol-3-yl)sulfanyl]hexan-1-ol;hydrochloride (PubChem CID 154906626) has the molecular formula C14H27ClN4OS and a molecular weight of 334.92 g/mol. Its IUPAC name is 6-[(4-methyl-5-piperidin-3-yl-1,2,4-triazol-3-yl)sulfanyl]hexan-1-ol;hydrochloride.
| Compound Name | 6-[(4-methyl-5-piperidin-3-yl-1,2,4-triazol-3-yl)sulfanyl]hexan-1-ol;hydrochloride |
|---|---|
| PubChem CID | 154906626 |
| Molecular Formula | C14H27ClN4OS |
| Molecular Weight | 334.92 g/mol |
| Exact Mass | 334.16 |
| IUPAC Name | 6-[(4-methyl-5-piperidin-3-yl-1,2,4-triazol-3-yl)sulfanyl]hexan-1-ol;hydrochloride |
| SMILES | Cl.Cn1c(SCCCCCCO)nnc1C1CCCNC1 |
| InChI | InChI=1S/C14H26N4OS.ClH/c1-18-13(12-7-6-8-15-11-12)16-17-14(18)20-10-5-3-2-4-9-19;/h12,15,19H,2-11H2,1H3;1H |
| InChIKey | CEZWYABRRJSFPM-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 62.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.92 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|