C17H22N4O2S — CID 31040173
3-[3-cyclopropyl-5-[2-(3-methylphenoxy)ethylsulfanyl]-1,2,4-triazol-4-yl]propanamide (PubChem CID 31040173) has the molecular formula C17H22N4O2S and a molecular weight of 346.46 g/mol. Its IUPAC name is 3-[3-cyclopropyl-5-[2-(3-methylphenoxy)ethylsulfanyl]-1,2,4-triazol-4-yl]propanamide.
| Compound Name | 3-[3-cyclopropyl-5-[2-(3-methylphenoxy)ethylsulfanyl]-1,2,4-triazol-4-yl]propanamide |
|---|---|
| PubChem CID | 31040173 |
| Molecular Formula | C17H22N4O2S |
| Molecular Weight | 346.46 g/mol |
| Exact Mass | 346.15 |
| IUPAC Name | 3-[3-cyclopropyl-5-[2-(3-methylphenoxy)ethylsulfanyl]-1,2,4-triazol-4-yl]propanamide |
| SMILES | Cc1cccc(OCCSc2nnc(C3CC3)n2CCC(N)=O)c1 |
| InChI | InChI=1S/C17H22N4O2S/c1-12-3-2-4-14(11-12)23-9-10-24-17-20-19-16(13-5-6-13)21(17)8-7-15(18)22/h2-4,11,13H,5-10H2,1H3,(H2,18,22) |
| InChIKey | VWWFGQXGPOWAGX-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.46 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|