C17H24N4OS — CID 18224956
3-cyclopropyl-5-[2-(3-methyl-4-propan-2-ylphenoxy)ethylsulfanyl]-1,2,4-triazol-4-amine (PubChem CID 18224956) has the molecular formula C17H24N4OS and a molecular weight of 332.47 g/mol. Its IUPAC name is 3-cyclopropyl-5-[2-(3-methyl-4-propan-2-ylphenoxy)ethylsulfanyl]-1,2,4-triazol-4-amine.
| Compound Name | 3-cyclopropyl-5-[2-(3-methyl-4-propan-2-ylphenoxy)ethylsulfanyl]-1,2,4-triazol-4-amine |
|---|---|
| PubChem CID | 18224956 |
| Molecular Formula | C17H24N4OS |
| Molecular Weight | 332.47 g/mol |
| Exact Mass | 332.17 |
| IUPAC Name | 3-cyclopropyl-5-[2-(3-methyl-4-propan-2-ylphenoxy)ethylsulfanyl]-1,2,4-triazol-4-amine |
| SMILES | Cc1cc(OCCSc2nnc(C3CC3)n2N)ccc1C(C)C |
| InChI | InChI=1S/C17H24N4OS/c1-11(2)15-7-6-14(10-12(15)3)22-8-9-23-17-20-19-16(21(17)18)13-4-5-13/h6-7,10-11,13H,4-5,8-9,18H2,1-3H3 |
| InChIKey | QAISLYPIFUVRPY-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.47 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|