C22H28N4O2S — CID 55317557
4-[4-(2-methoxyethyl)-5-[2-(3-methyl-4-propan-2-ylphenoxy)ethylsulfanyl]-1,2,4-triazol-3-yl]pyridine (PubChem CID 55317557) has the molecular formula C22H28N4O2S and a molecular weight of 412.56 g/mol. Its IUPAC name is 4-[4-(2-methoxyethyl)-5-[2-(3-methyl-4-propan-2-ylphenoxy)ethylsulfanyl]-1,2,4-triazol-3-yl]pyridine.
| Compound Name | 4-[4-(2-methoxyethyl)-5-[2-(3-methyl-4-propan-2-ylphenoxy)ethylsulfanyl]-1,2,4-triazol-3-yl]pyridine |
|---|---|
| PubChem CID | 55317557 |
| Molecular Formula | C22H28N4O2S |
| Molecular Weight | 412.56 g/mol |
| Exact Mass | 412.19 |
| IUPAC Name | 4-[4-(2-methoxyethyl)-5-[2-(3-methyl-4-propan-2-ylphenoxy)ethylsulfanyl]-1,2,4-triazol-3-yl]pyridine |
| SMILES | COCCn1c(SCCOc2ccc(C(C)C)c(C)c2)nnc1-c1ccncc1 |
| InChI | InChI=1S/C22H28N4O2S/c1-16(2)20-6-5-19(15-17(20)3)28-13-14-29-22-25-24-21(26(22)11-12-27-4)18-7-9-23-10-8-18/h5-10,15-16H,11-14H2,1-4H3 |
| InChIKey | YWRLNHBMUJRIFM-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 62.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.56 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|