C20H23N3OS — CID 112785571
4-benzyl-3-[2-(2,5-dimethylphenoxy)ethylsulfanyl]-5-methyl-1,2,4-triazole (PubChem CID 112785571) has the molecular formula C20H23N3OS and a molecular weight of 353.49 g/mol. Its IUPAC name is 4-benzyl-3-[2-(2,5-dimethylphenoxy)ethylsulfanyl]-5-methyl-1,2,4-triazole.
| Compound Name | 4-benzyl-3-[2-(2,5-dimethylphenoxy)ethylsulfanyl]-5-methyl-1,2,4-triazole |
|---|---|
| PubChem CID | 112785571 |
| Molecular Formula | C20H23N3OS |
| Molecular Weight | 353.49 g/mol |
| Exact Mass | 353.16 |
| IUPAC Name | 4-benzyl-3-[2-(2,5-dimethylphenoxy)ethylsulfanyl]-5-methyl-1,2,4-triazole |
| SMILES | Cc1ccc(C)c(OCCSc2nnc(C)n2Cc2ccccc2)c1 |
| InChI | InChI=1S/C20H23N3OS/c1-15-9-10-16(2)19(13-15)24-11-12-25-20-22-21-17(3)23(20)14-18-7-5-4-6-8-18/h4-10,13H,11-12,14H2,1-3H3 |
| InChIKey | AFUZGGPWPWPSLU-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.49 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|