C18H20N4OS — CID 112776173
1-(2,4-dimethylphenyl)-5-[2-(2-methylphenoxy)ethylsulfanyl]tetrazole (PubChem CID 112776173) has the molecular formula C18H20N4OS and a molecular weight of 340.45 g/mol. Its IUPAC name is 1-(2,4-dimethylphenyl)-5-[2-(2-methylphenoxy)ethylsulfanyl]tetrazole.
| Compound Name | 1-(2,4-dimethylphenyl)-5-[2-(2-methylphenoxy)ethylsulfanyl]tetrazole |
|---|---|
| PubChem CID | 112776173 |
| Molecular Formula | C18H20N4OS |
| Molecular Weight | 340.45 g/mol |
| Exact Mass | 340.14 |
| IUPAC Name | 1-(2,4-dimethylphenyl)-5-[2-(2-methylphenoxy)ethylsulfanyl]tetrazole |
| SMILES | Cc1ccc(-n2nnnc2SCCOc2ccccc2C)c(C)c1 |
| InChI | InChI=1S/C18H20N4OS/c1-13-8-9-16(15(3)12-13)22-18(19-20-21-22)24-11-10-23-17-7-5-4-6-14(17)2/h4-9,12H,10-11H2,1-3H3 |
| InChIKey | QTNXXDWKKSFQST-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 52.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.45 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|