C17H17FN4O2S — CID 2113935
5-[2-(2-fluorophenoxy)ethylsulfanyl]-1-(2-methoxy-5-methylphenyl)tetrazole (PubChem CID 2113935) has the molecular formula C17H17FN4O2S and a molecular weight of 360.41 g/mol. Its IUPAC name is 5-[2-(2-fluorophenoxy)ethylsulfanyl]-1-(2-methoxy-5-methylphenyl)tetrazole.
| Compound Name | 5-[2-(2-fluorophenoxy)ethylsulfanyl]-1-(2-methoxy-5-methylphenyl)tetrazole |
|---|---|
| PubChem CID | 2113935 |
| Molecular Formula | C17H17FN4O2S |
| Molecular Weight | 360.41 g/mol |
| Exact Mass | 360.11 |
| IUPAC Name | 5-[2-(2-fluorophenoxy)ethylsulfanyl]-1-(2-methoxy-5-methylphenyl)tetrazole |
| SMILES | COc1ccc(C)cc1-n1nnnc1SCCOc1ccccc1F |
| InChI | InChI=1S/C17H17FN4O2S/c1-12-7-8-16(23-2)14(11-12)22-17(19-20-21-22)25-10-9-24-15-6-4-3-5-13(15)18/h3-8,11H,9-10H2,1-2H3 |
| InChIKey | ZOOQKOPPQYLAHO-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 62.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.41 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|