C12H16N4OS2 — CID 56795434
1-(2-methoxyphenyl)-5-(3-methylsulfanylpropylsulfanyl)tetrazole (PubChem CID 56795434) has the molecular formula C12H16N4OS2 and a molecular weight of 296.42 g/mol. Its IUPAC name is 1-(2-methoxyphenyl)-5-(3-methylsulfanylpropylsulfanyl)tetrazole.
| Compound Name | 1-(2-methoxyphenyl)-5-(3-methylsulfanylpropylsulfanyl)tetrazole |
|---|---|
| PubChem CID | 56795434 |
| Molecular Formula | C12H16N4OS2 |
| Molecular Weight | 296.42 g/mol |
| Exact Mass | 296.08 |
| IUPAC Name | 1-(2-methoxyphenyl)-5-(3-methylsulfanylpropylsulfanyl)tetrazole |
| SMILES | COc1ccccc1-n1nnnc1SCCCSC |
| InChI | InChI=1S/C12H16N4OS2/c1-17-11-7-4-3-6-10(11)16-12(13-14-15-16)19-9-5-8-18-2/h3-4,6-7H,5,8-9H2,1-2H3 |
| InChIKey | ICAABBOVXOVPMD-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 52.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.42 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|