C12H12Cl2N4OS — CID 41075430
5-[[(1S)-2,2-dichlorocyclopropyl]methylsulfanyl]-1-(2-methoxyphenyl)tetrazole (PubChem CID 41075430) has the molecular formula C12H12Cl2N4OS and a molecular weight of 331.23 g/mol. Its IUPAC name is 5-[[(1S)-2,2-dichlorocyclopropyl]methylsulfanyl]-1-(2-methoxyphenyl)tetrazole.
| Compound Name | 5-[[(1S)-2,2-dichlorocyclopropyl]methylsulfanyl]-1-(2-methoxyphenyl)tetrazole |
|---|---|
| PubChem CID | 41075430 |
| Molecular Formula | C12H12Cl2N4OS |
| Molecular Weight | 331.23 g/mol |
| Exact Mass | 330.01 |
| IUPAC Name | 5-[[(1S)-2,2-dichlorocyclopropyl]methylsulfanyl]-1-(2-methoxyphenyl)tetrazole |
| SMILES | COc1ccccc1-n1nnnc1SC[C@@H]1CC1(Cl)Cl |
| InChI | InChI=1S/C12H12Cl2N4OS/c1-19-10-5-3-2-4-9(10)18-11(15-16-17-18)20-7-8-6-12(8,13)14/h2-5,8H,6-7H2,1H3/t8-/m0/s1 |
| InChIKey | KXNOPYIBHIRTSA-QMMMGPOBSA-N |
| XLogP | 2.96 |
| TPSA | 52.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.23 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|