C17H24N6O2S — CID 8693588
N-(1-ethylpiperidin-4-yl)-2-[1-(2-methoxyphenyl)tetrazol-5-yl]sulfanylacetamide (PubChem CID 8693588) has the molecular formula C17H24N6O2S and a molecular weight of 376.49 g/mol. Its IUPAC name is N-(1-ethylpiperidin-4-yl)-2-[1-(2-methoxyphenyl)tetrazol-5-yl]sulfanylacetamide.
| Compound Name | N-(1-ethylpiperidin-4-yl)-2-[1-(2-methoxyphenyl)tetrazol-5-yl]sulfanylacetamide |
|---|---|
| PubChem CID | 8693588 |
| Molecular Formula | C17H24N6O2S |
| Molecular Weight | 376.49 g/mol |
| Exact Mass | 376.17 |
| IUPAC Name | N-(1-ethylpiperidin-4-yl)-2-[1-(2-methoxyphenyl)tetrazol-5-yl]sulfanylacetamide |
| SMILES | CCN1CCC(NC(=O)CSc2nnnn2-c2ccccc2OC)CC1 |
| InChI | InChI=1S/C17H24N6O2S/c1-3-22-10-8-13(9-11-22)18-16(24)12-26-17-19-20-21-23(17)14-6-4-5-7-15(14)25-2/h4-7,13H,3,8-12H2,1-2H3,(H,18,24) |
| InChIKey | LRZITFIWIGMCOP-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 85.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.49 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |