C17H21N5O2S — CID 31015147
N-(dicyclopropylmethyl)-2-[1-(2-methoxyphenyl)tetrazol-5-yl]sulfanylacetamide (PubChem CID 31015147) has the molecular formula C17H21N5O2S and a molecular weight of 359.46 g/mol. Its IUPAC name is N-(dicyclopropylmethyl)-2-[1-(2-methoxyphenyl)tetrazol-5-yl]sulfanylacetamide.
| Compound Name | N-(dicyclopropylmethyl)-2-[1-(2-methoxyphenyl)tetrazol-5-yl]sulfanylacetamide |
|---|---|
| PubChem CID | 31015147 |
| Molecular Formula | C17H21N5O2S |
| Molecular Weight | 359.46 g/mol |
| Exact Mass | 359.14 |
| IUPAC Name | N-(dicyclopropylmethyl)-2-[1-(2-methoxyphenyl)tetrazol-5-yl]sulfanylacetamide |
| SMILES | COc1ccccc1-n1nnnc1SCC(=O)NC(C1CC1)C1CC1 |
| InChI | InChI=1S/C17H21N5O2S/c1-24-14-5-3-2-4-13(14)22-17(19-20-21-22)25-10-15(23)18-16(11-6-7-11)12-8-9-12/h2-5,11-12,16H,6-10H2,1H3,(H,18,23) |
| InChIKey | UKUWTNYQBRIQMD-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.46 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |