C13H15N7S — CID 80883518
N-methyl-5-propyl-6-(7H-purin-6-ylsulfanyl)pyrimidin-4-amine (PubChem CID 80883518) has the molecular formula C13H15N7S and a molecular weight of 301.38 g/mol. Its IUPAC name is N-methyl-5-propyl-6-(7H-purin-6-ylsulfanyl)pyrimidin-4-amine.
| Compound Name | N-methyl-5-propyl-6-(7H-purin-6-ylsulfanyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 80883518 |
| Molecular Formula | C13H15N7S |
| Molecular Weight | 301.38 g/mol |
| Exact Mass | 301.11 |
| IUPAC Name | N-methyl-5-propyl-6-(7H-purin-6-ylsulfanyl)pyrimidin-4-amine |
| SMILES | CCCc1c(NC)ncnc1Sc1ncnc2nc[nH]c12 |
| InChI | InChI=1S/C13H15N7S/c1-3-4-8-10(14-2)16-6-19-12(8)21-13-9-11(17-5-15-9)18-7-20-13/h5-7H,3-4H2,1-2H3,(H,14,16,19)(H,15,17,18,20) |
| InChIKey | VKYUVFDATCTEOP-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 92.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.38 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |