C11H14N4S2 — CID 80886227
N-methyl-5-propyl-6-(1,3-thiazol-2-ylsulfanyl)pyrimidin-4-amine (PubChem CID 80886227) has the molecular formula C11H14N4S2 and a molecular weight of 266.39 g/mol. Its IUPAC name is N-methyl-5-propyl-6-(1,3-thiazol-2-ylsulfanyl)pyrimidin-4-amine.
| Compound Name | N-methyl-5-propyl-6-(1,3-thiazol-2-ylsulfanyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 80886227 |
| Molecular Formula | C11H14N4S2 |
| Molecular Weight | 266.39 g/mol |
| Exact Mass | 266.07 |
| IUPAC Name | N-methyl-5-propyl-6-(1,3-thiazol-2-ylsulfanyl)pyrimidin-4-amine |
| SMILES | CCCc1c(NC)ncnc1Sc1nccs1 |
| InChI | InChI=1S/C11H14N4S2/c1-3-4-8-9(12-2)14-7-15-10(8)17-11-13-5-6-16-11/h5-7H,3-4H2,1-2H3,(H,12,14,15) |
| InChIKey | ZVRIOZXMRRDWGP-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.39 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'} |
|---|