C8H9N7O3S — CID 114045260
[4-methyl-6-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]-5-nitropyrimidin-2-yl]hydrazine (PubChem CID 114045260) has the molecular formula C8H9N7O3S and a molecular weight of 283.27 g/mol. Its IUPAC name is [4-methyl-6-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]-5-nitropyrimidin-2-yl]hydrazine.
| Compound Name | [4-methyl-6-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]-5-nitropyrimidin-2-yl]hydrazine |
|---|---|
| PubChem CID | 114045260 |
| Molecular Formula | C8H9N7O3S |
| Molecular Weight | 283.27 g/mol |
| Exact Mass | 283.05 |
| IUPAC Name | [4-methyl-6-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]-5-nitropyrimidin-2-yl]hydrazine |
| SMILES | Cc1nnc(Sc2nc(NN)nc(C)c2[N+](=O)[O-])o1 |
| InChI | InChI=1S/C8H9N7O3S/c1-3-5(15(16)17)6(11-7(10-3)12-9)19-8-14-13-4(2)18-8/h9H2,1-2H3,(H,10,11,12) |
| InChIKey | QWZKHEIENITIPC-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 145.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.27 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|