C7H6N6O3S — CID 114044810
4-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]-5-nitropyrimidin-2-amine (PubChem CID 114044810) has the molecular formula C7H6N6O3S and a molecular weight of 254.23 g/mol. Its IUPAC name is 4-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]-5-nitropyrimidin-2-amine.
| Compound Name | 4-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]-5-nitropyrimidin-2-amine |
|---|---|
| PubChem CID | 114044810 |
| Molecular Formula | C7H6N6O3S |
| Molecular Weight | 254.23 g/mol |
| Exact Mass | 254.02 |
| IUPAC Name | 4-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]-5-nitropyrimidin-2-amine |
| SMILES | Cc1nnc(Sc2nc(N)ncc2[N+](=O)[O-])o1 |
| InChI | InChI=1S/C7H6N6O3S/c1-3-11-12-7(16-3)17-5-4(13(14)15)2-9-6(8)10-5/h2H,1H3,(H2,8,9,10) |
| InChIKey | VMYCSWHFTRCPTM-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 133.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.23 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|