C8H7N5O3S — CID 114044840
4-methyl-5-nitro-6-(1,3-oxazol-2-ylsulfanyl)pyrimidin-2-amine (PubChem CID 114044840) has the molecular formula C8H7N5O3S and a molecular weight of 253.24 g/mol. Its IUPAC name is 4-methyl-5-nitro-6-(1,3-oxazol-2-ylsulfanyl)pyrimidin-2-amine.
| Compound Name | 4-methyl-5-nitro-6-(1,3-oxazol-2-ylsulfanyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 114044840 |
| Molecular Formula | C8H7N5O3S |
| Molecular Weight | 253.24 g/mol |
| Exact Mass | 253.03 |
| IUPAC Name | 4-methyl-5-nitro-6-(1,3-oxazol-2-ylsulfanyl)pyrimidin-2-amine |
| SMILES | Cc1nc(N)nc(Sc2ncco2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C8H7N5O3S/c1-4-5(13(14)15)6(12-7(9)11-4)17-8-10-2-3-16-8/h2-3H,1H3,(H2,9,11,12) |
| InChIKey | LLTVKVONRWNKNV-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 120.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.24 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|