C11H14N6O3S — CID 106384196
4-[[[5-nitro-6-(propylamino)pyrimidin-4-yl]amino]methyl]-3H-1,3-thiazol-2-one (PubChem CID 106384196) has the molecular formula C11H14N6O3S and a molecular weight of 310.34 g/mol. Its IUPAC name is 4-[[[5-nitro-6-(propylamino)pyrimidin-4-yl]amino]methyl]-3H-1,3-thiazol-2-one.
| Compound Name | 4-[[[5-nitro-6-(propylamino)pyrimidin-4-yl]amino]methyl]-3H-1,3-thiazol-2-one |
|---|---|
| PubChem CID | 106384196 |
| Molecular Formula | C11H14N6O3S |
| Molecular Weight | 310.34 g/mol |
| Exact Mass | 310.08 |
| IUPAC Name | 4-[[[5-nitro-6-(propylamino)pyrimidin-4-yl]amino]methyl]-3H-1,3-thiazol-2-one |
| SMILES | CCCNc1ncnc(NCc2csc(=O)[nH]2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C11H14N6O3S/c1-2-3-12-9-8(17(19)20)10(15-6-14-9)13-4-7-5-21-11(18)16-7/h5-6H,2-4H2,1H3,(H,16,18)(H2,12,13,14,15) |
| InChIKey | RCVXLXAUSJAKOI-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 125.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.34 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|