C11H11ClN4O2S — CID 107361032
6-(3-chlorothiophen-2-yl)-5-nitro-N-propylpyrimidin-4-amine (PubChem CID 107361032) has the molecular formula C11H11ClN4O2S and a molecular weight of 298.75 g/mol. Its IUPAC name is 6-(3-chlorothiophen-2-yl)-5-nitro-N-propylpyrimidin-4-amine.
| Compound Name | 6-(3-chlorothiophen-2-yl)-5-nitro-N-propylpyrimidin-4-amine |
|---|---|
| PubChem CID | 107361032 |
| Molecular Formula | C11H11ClN4O2S |
| Molecular Weight | 298.75 g/mol |
| Exact Mass | 298.03 |
| IUPAC Name | 6-(3-chlorothiophen-2-yl)-5-nitro-N-propylpyrimidin-4-amine |
| SMILES | CCCNc1ncnc(-c2sccc2Cl)c1[N+](=O)[O-] |
| InChI | InChI=1S/C11H11ClN4O2S/c1-2-4-13-11-9(16(17)18)8(14-6-15-11)10-7(12)3-5-19-10/h3,5-6H,2,4H2,1H3,(H,13,14,15) |
| InChIKey | BCQJXQITEQYUTC-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 80.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.75 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|