C13H12ClFN4O2 — CID 105396181
6-(2-chloro-5-fluorophenyl)-5-nitro-N-propylpyrimidin-4-amine (PubChem CID 105396181) has the molecular formula C13H12ClFN4O2 and a molecular weight of 310.72 g/mol. Its IUPAC name is 6-(2-chloro-5-fluorophenyl)-5-nitro-N-propylpyrimidin-4-amine.
| Compound Name | 6-(2-chloro-5-fluorophenyl)-5-nitro-N-propylpyrimidin-4-amine |
|---|---|
| PubChem CID | 105396181 |
| Molecular Formula | C13H12ClFN4O2 |
| Molecular Weight | 310.72 g/mol |
| Exact Mass | 310.06 |
| IUPAC Name | 6-(2-chloro-5-fluorophenyl)-5-nitro-N-propylpyrimidin-4-amine |
| SMILES | CCCNc1ncnc(-c2cc(F)ccc2Cl)c1[N+](=O)[O-] |
| InChI | InChI=1S/C13H12ClFN4O2/c1-2-5-16-13-12(19(20)21)11(17-7-18-13)9-6-8(15)3-4-10(9)14/h3-4,6-7H,2,5H2,1H3,(H,16,17,18) |
| InChIKey | JHOSXBMCCSTJOC-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 80.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.72 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|