About 5-nitro-2-(2-oxopropyl)-4H-1,2,4-triazol-3-one
5-nitro-2-(2-oxopropyl)-4H-1,2,4-triazol-3-one (PubChem CID 135417372) has the molecular formula C5H6N4O4
and a molecular weight of 186.13 g/mol. Its IUPAC name is 5-nitro-2-(2-oxopropyl)-4H-1,2,4-triazol-3-one.
Molecular Properties
| Compound Name | 5-nitro-2-(2-oxopropyl)-4H-1,2,4-triazol-3-one |
| PubChem CID | 135417372 |
| Molecular Formula | C5H6N4O4 |
| Molecular Weight | 186.13 g/mol |
| Exact Mass | 186.04 |
| IUPAC Name | 5-nitro-2-(2-oxopropyl)-4H-1,2,4-triazol-3-one |
| SMILES | CC(=O)Cn1nc([N+](=O)[O-])[nH]c1=O |
| InChI | InChI=1S/C5H6N4O4/c1-3(10)2-8-5(11)6-4(7-8)9(12)13/h2H2,1H3,(H,6,7,11) |
| InChIKey | XVPHMZRAJUYGSN-UHFFFAOYSA-N |
| XLogP | -0.93 |
| TPSA | 110.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.13 |
| LogP ≤ 5 | -0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-nitro-2-(2-oxopropyl)-4H-1,2,4-triazol-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-nitro-2-(2-oxopropyl)-4H-1,2,4-triazol-3-one?
The IUPAC name of 5-nitro-2-(2-oxopropyl)-4H-1,2,4-triazol-3-one (CID 135417372) is 5-nitro-2-(2-oxopropyl)-4H-1,2,4-triazol-3-one.
What is the SMILES notation for 5-nitro-2-(2-oxopropyl)-4H-1,2,4-triazol-3-one?
The canonical SMILES for 5-nitro-2-(2-oxopropyl)-4H-1,2,4-triazol-3-one is CC(=O)Cn1nc([N+](=O)[O-])[nH]c1=O.
What is the InChIKey of 5-nitro-2-(2-oxopropyl)-4H-1,2,4-triazol-3-one?
The InChIKey is XVPHMZRAJUYGSN-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6N4O4/c1-3(10)2-8-5(11)6-4(7-8)9(12)13/h2H2,1H3,(H,6,7,11).
What are the key properties of 5-nitro-2-(2-oxopropyl)-4H-1,2,4-triazol-3-one?
5-nitro-2-(2-oxopropyl)-4H-1,2,4-triazol-3-one has a molecular weight of 186.13 g/mol, XLogP of -0.93, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-nitro-2-(2-oxopropyl)-4H-1,2,4-triazol-3-one is sourced from PubChem (CID 135417372), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).