C3H4N4O4 — CID 135778871
2-(hydroxymethyl)-5-nitro-4H-1,2,4-triazol-3-one (PubChem CID 135778871) has the molecular formula C3H4N4O4 and a molecular weight of 160.09 g/mol. Its IUPAC name is 2-(hydroxymethyl)-5-nitro-4H-1,2,4-triazol-3-one.
| Compound Name | 2-(hydroxymethyl)-5-nitro-4H-1,2,4-triazol-3-one |
|---|---|
| PubChem CID | 135778871 |
| Molecular Formula | C3H4N4O4 |
| Molecular Weight | 160.09 g/mol |
| Exact Mass | 160.02 |
| IUPAC Name | 2-(hydroxymethyl)-5-nitro-4H-1,2,4-triazol-3-one |
| SMILES | O=c1[nH]c([N+](=O)[O-])nn1CO |
| InChI | InChI=1S/C3H4N4O4/c8-1-6-3(9)4-2(5-6)7(10)11/h8H,1H2,(H,4,5,9) |
| InChIKey | PVFCSYABWXEYPR-UHFFFAOYSA-N |
| XLogP | -1.57 |
| TPSA | 114.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.09 |
| LogP ≤ 5 | -1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|