C12H10Cl2N6O8 — CID 10646611
6-chloro-3-[4-(6-chloro-5-nitro-2,4-dioxo-1H-pyrimidin-3-yl)butyl]-5-nitro-1H-pyrimidine-2,4-dione (PubChem CID 10646611) has the molecular formula C12H10Cl2N6O8 and a molecular weight of 437.15 g/mol. Its IUPAC name is 6-chloro-3-[4-(6-chloro-5-nitro-2,4-dioxo-1H-pyrimidin-3-yl)butyl]-5-nitro-1H-pyrimidine-2,4-dione.
| Compound Name | 6-chloro-3-[4-(6-chloro-5-nitro-2,4-dioxo-1H-pyrimidin-3-yl)butyl]-5-nitro-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 10646611 |
| Molecular Formula | C12H10Cl2N6O8 |
| Molecular Weight | 437.15 g/mol |
| Exact Mass | 435.99 |
| IUPAC Name | 6-chloro-3-[4-(6-chloro-5-nitro-2,4-dioxo-1H-pyrimidin-3-yl)butyl]-5-nitro-1H-pyrimidine-2,4-dione |
| SMILES | O=c1[nH]c(Cl)c([N+](=O)[O-])c(=O)n1CCCCn1c(=O)[nH]c(Cl)c([N+](=O)[O-])c1=O |
| InChI | InChI=1S/C12H10Cl2N6O8/c13-7-5(19(25)26)9(21)17(11(23)15-7)3-1-2-4-18-10(22)6(20(27)28)8(14)16-12(18)24/h1-4H2,(H,15,23)(H,16,24) |
| InChIKey | FNBJXSUHPRARIA-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 196.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.15 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|