C9H11N5O8 — CID 141142612
2,3,4,5-tetranitro-1-pentylpyrrole (PubChem CID 141142612) has the molecular formula C9H11N5O8 and a molecular weight of 317.21 g/mol. Its IUPAC name is 2,3,4,5-tetranitro-1-pentylpyrrole.
| Compound Name | 2,3,4,5-tetranitro-1-pentylpyrrole |
|---|---|
| PubChem CID | 141142612 |
| Molecular Formula | C9H11N5O8 |
| Molecular Weight | 317.21 g/mol |
| Exact Mass | 317.06 |
| IUPAC Name | 2,3,4,5-tetranitro-1-pentylpyrrole |
| SMILES | CCCCCn1c([N+](=O)[O-])c([N+](=O)[O-])c([N+](=O)[O-])c1[N+](=O)[O-] |
| InChI | InChI=1S/C9H11N5O8/c1-2-3-4-5-10-8(13(19)20)6(11(15)16)7(12(17)18)9(10)14(21)22/h2-5H2,1H3 |
| InChIKey | PURLEYDXAINERQ-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 177.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.21 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|