About 4-nitro-1-octylpyrazole
4-nitro-1-octylpyrazole (PubChem CID 50999936) has the molecular formula C11H19N3O2
and a molecular weight of 225.29 g/mol. Its IUPAC name is 4-nitro-1-octylpyrazole.
Molecular Properties
| Compound Name | 4-nitro-1-octylpyrazole |
| PubChem CID | 50999936 |
| Molecular Formula | C11H19N3O2 |
| Molecular Weight | 225.29 g/mol |
| Exact Mass | 225.15 |
| IUPAC Name | 4-nitro-1-octylpyrazole |
| SMILES | CCCCCCCCn1cc([N+](=O)[O-])cn1 |
| InChI | InChI=1S/C11H19N3O2/c1-2-3-4-5-6-7-8-13-10-11(9-12-13)14(15)16/h9-10H,2-8H2,1H3 |
| InChIKey | PZFQXDAQPKNXII-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 60.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.29 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-nitro-1-octylpyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-nitro-1-octylpyrazole?
The IUPAC name of 4-nitro-1-octylpyrazole (CID 50999936) is 4-nitro-1-octylpyrazole.
What is the SMILES notation for 4-nitro-1-octylpyrazole?
The canonical SMILES for 4-nitro-1-octylpyrazole is CCCCCCCCn1cc([N+](=O)[O-])cn1.
What is the InChIKey of 4-nitro-1-octylpyrazole?
The InChIKey is PZFQXDAQPKNXII-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19N3O2/c1-2-3-4-5-6-7-8-13-10-11(9-12-13)14(15)16/h9-10H,2-8H2,1H3.
What are the key properties of 4-nitro-1-octylpyrazole?
4-nitro-1-octylpyrazole has a molecular weight of 225.29 g/mol, XLogP of 3.15, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-nitro-1-octylpyrazole is sourced from PubChem (CID 50999936), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).