About fluoroethane;1-(2-fluoroethyl)-4-nitropyrazole
fluoroethane;1-(2-fluoroethyl)-4-nitropyrazole (PubChem CID 176710740) has the molecular formula C7H11F2N3O2
and a molecular weight of 207.18 g/mol. Its IUPAC name is fluoroethane;1-(2-fluoroethyl)-4-nitropyrazole.
Molecular Properties
| Compound Name | fluoroethane;1-(2-fluoroethyl)-4-nitropyrazole |
| PubChem CID | 176710740 |
| Molecular Formula | C7H11F2N3O2 |
| Molecular Weight | 207.18 g/mol |
| Exact Mass | 207.08 |
| IUPAC Name | fluoroethane;1-(2-fluoroethyl)-4-nitropyrazole |
| SMILES | CCF.O=[N+]([O-])c1cnn(CCF)c1 |
| InChI | InChI=1S/C5H6FN3O2.C2H5F/c6-1-2-8-4-5(3-7-8)9(10)11;1-2-3/h3-4H,1-2H2;2H2,1H3 |
| InChIKey | SPIGQFFAMVLHAQ-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 60.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.18 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze fluoroethane;1-(2-fluoroethyl)-4-nitropyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of fluoroethane;1-(2-fluoroethyl)-4-nitropyrazole?
The IUPAC name of fluoroethane;1-(2-fluoroethyl)-4-nitropyrazole (CID 176710740) is fluoroethane;1-(2-fluoroethyl)-4-nitropyrazole.
What is the SMILES notation for fluoroethane;1-(2-fluoroethyl)-4-nitropyrazole?
The canonical SMILES for fluoroethane;1-(2-fluoroethyl)-4-nitropyrazole is CCF.O=[N+]([O-])c1cnn(CCF)c1.
What is the InChIKey of fluoroethane;1-(2-fluoroethyl)-4-nitropyrazole?
The InChIKey is SPIGQFFAMVLHAQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6FN3O2.C2H5F/c6-1-2-8-4-5(3-7-8)9(10)11;1-2-3/h3-4H,1-2H2;2H2,1H3.
What are the key properties of fluoroethane;1-(2-fluoroethyl)-4-nitropyrazole?
fluoroethane;1-(2-fluoroethyl)-4-nitropyrazole has a molecular weight of 207.18 g/mol, XLogP of 1.74, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for fluoroethane;1-(2-fluoroethyl)-4-nitropyrazole is sourced from PubChem (CID 176710740), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).