C8H11N3O5 — CID 16757004
1-(ethoxymethyl)-6-methyl-5-nitropyrimidine-2,4-dione (PubChem CID 16757004) has the molecular formula C8H11N3O5 and a molecular weight of 229.19 g/mol. Its IUPAC name is 1-(ethoxymethyl)-6-methyl-5-nitropyrimidine-2,4-dione.
| Compound Name | 1-(ethoxymethyl)-6-methyl-5-nitropyrimidine-2,4-dione |
|---|---|
| PubChem CID | 16757004 |
| Molecular Formula | C8H11N3O5 |
| Molecular Weight | 229.19 g/mol |
| Exact Mass | 229.07 |
| IUPAC Name | 1-(ethoxymethyl)-6-methyl-5-nitropyrimidine-2,4-dione |
| SMILES | CCOCn1c(C)c([N+](=O)[O-])c(=O)[nH]c1=O |
| InChI | InChI=1S/C8H11N3O5/c1-3-16-4-10-5(2)6(11(14)15)7(12)9-8(10)13/h3-4H2,1-2H3,(H,9,12,13) |
| InChIKey | SRUCJMWMFVPCSC-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 107.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.19 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|