C8H12N4O5 — CID 11746851
6-(3-hydroxypropylamino)-3-methyl-5-nitro-1H-pyrimidine-2,4-dione (PubChem CID 11746851) has the molecular formula C8H12N4O5 and a molecular weight of 244.21 g/mol. Its IUPAC name is 6-(3-hydroxypropylamino)-3-methyl-5-nitro-1H-pyrimidine-2,4-dione.
| Compound Name | 6-(3-hydroxypropylamino)-3-methyl-5-nitro-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 11746851 |
| Molecular Formula | C8H12N4O5 |
| Molecular Weight | 244.21 g/mol |
| Exact Mass | 244.08 |
| IUPAC Name | 6-(3-hydroxypropylamino)-3-methyl-5-nitro-1H-pyrimidine-2,4-dione |
| SMILES | Cn1c(=O)[nH]c(NCCCO)c([N+](=O)[O-])c1=O |
| InChI | InChI=1S/C8H12N4O5/c1-11-7(14)5(12(16)17)6(10-8(11)15)9-3-2-4-13/h9,13H,2-4H2,1H3,(H,10,15) |
| InChIKey | SNFFCFYGCZVKME-UHFFFAOYSA-N |
| XLogP | -1.22 |
| TPSA | 130.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.21 |
| LogP ≤ 5 | -1.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|