About 4-hydroxy-1,6-dimethyl-3-nitropyridin-2-one
4-hydroxy-1,6-dimethyl-3-nitropyridin-2-one (PubChem CID 54708954) has the molecular formula C7H8N2O4
and a molecular weight of 184.15 g/mol. Its IUPAC name is 4-hydroxy-1,6-dimethyl-3-nitropyridin-2-one.
Molecular Properties
| Compound Name | 4-hydroxy-1,6-dimethyl-3-nitropyridin-2-one |
| PubChem CID | 54708954 |
| Molecular Formula | C7H8N2O4 |
| Molecular Weight | 184.15 g/mol |
| Exact Mass | 184.05 |
| IUPAC Name | 4-hydroxy-1,6-dimethyl-3-nitropyridin-2-one |
| SMILES | Cc1cc(O)c([N+](=O)[O-])c(=O)n1C |
| InChI | InChI=1S/C7H8N2O4/c1-4-3-5(10)6(9(12)13)7(11)8(4)2/h3,10H,1-2H3 |
| InChIKey | KVSGLQJHGFHBTA-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 85.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.15 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-hydroxy-1,6-dimethyl-3-nitropyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-hydroxy-1,6-dimethyl-3-nitropyridin-2-one?
The IUPAC name of 4-hydroxy-1,6-dimethyl-3-nitropyridin-2-one (CID 54708954) is 4-hydroxy-1,6-dimethyl-3-nitropyridin-2-one.
What is the SMILES notation for 4-hydroxy-1,6-dimethyl-3-nitropyridin-2-one?
The canonical SMILES for 4-hydroxy-1,6-dimethyl-3-nitropyridin-2-one is Cc1cc(O)c([N+](=O)[O-])c(=O)n1C.
What is the InChIKey of 4-hydroxy-1,6-dimethyl-3-nitropyridin-2-one?
The InChIKey is KVSGLQJHGFHBTA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N2O4/c1-4-3-5(10)6(9(12)13)7(11)8(4)2/h3,10H,1-2H3.
What are the key properties of 4-hydroxy-1,6-dimethyl-3-nitropyridin-2-one?
4-hydroxy-1,6-dimethyl-3-nitropyridin-2-one has a molecular weight of 184.15 g/mol, XLogP of 0.31, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-hydroxy-1,6-dimethyl-3-nitropyridin-2-one is sourced from PubChem (CID 54708954), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).