C13H12BrNO2S — CID 135033848
3-(4-bromophenyl)sulfanyl-4-hydroxy-1,6-dimethylpyridin-2-one (PubChem CID 135033848) has the molecular formula C13H12BrNO2S and a molecular weight of 326.22 g/mol. Its IUPAC name is 3-(4-bromophenyl)sulfanyl-4-hydroxy-1,6-dimethylpyridin-2-one.
| Compound Name | 3-(4-bromophenyl)sulfanyl-4-hydroxy-1,6-dimethylpyridin-2-one |
|---|---|
| PubChem CID | 135033848 |
| Molecular Formula | C13H12BrNO2S |
| Molecular Weight | 326.22 g/mol |
| Exact Mass | 324.98 |
| IUPAC Name | 3-(4-bromophenyl)sulfanyl-4-hydroxy-1,6-dimethylpyridin-2-one |
| SMILES | Cc1cc(O)c(Sc2ccc(Br)cc2)c(=O)n1C |
| InChI | InChI=1S/C13H12BrNO2S/c1-8-7-11(16)12(13(17)15(8)2)18-10-5-3-9(14)4-6-10/h3-7,16H,1-2H3 |
| InChIKey | JDUAFYPRUSEYHY-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.22 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |