C23H18O3S2 — CID 102503603
7-hydroxy-6,8-bis[(4-methylphenyl)sulfanyl]chromen-2-one (PubChem CID 102503603) has the molecular formula C23H18O3S2 and a molecular weight of 406.53 g/mol. Its IUPAC name is 7-hydroxy-6,8-bis[(4-methylphenyl)sulfanyl]chromen-2-one.
| Compound Name | 7-hydroxy-6,8-bis[(4-methylphenyl)sulfanyl]chromen-2-one |
|---|---|
| PubChem CID | 102503603 |
| Molecular Formula | C23H18O3S2 |
| Molecular Weight | 406.53 g/mol |
| Exact Mass | 406.07 |
| IUPAC Name | 7-hydroxy-6,8-bis[(4-methylphenyl)sulfanyl]chromen-2-one |
| SMILES | Cc1ccc(Sc2cc3ccc(=O)oc3c(Sc3ccc(C)cc3)c2O)cc1 |
| InChI | InChI=1S/C23H18O3S2/c1-14-3-8-17(9-4-14)27-19-13-16-7-12-20(24)26-22(16)23(21(19)25)28-18-10-5-15(2)6-11-18/h3-13,25H,1-2H3 |
| InChIKey | GRLLDTHLYRQRBB-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 50.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.53 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|