C20H16Br2S2 — CID 58715679
1,2-bis[(4-bromophenyl)sulfanyl]-4,5-dimethylbenzene (PubChem CID 58715679) has the molecular formula C20H16Br2S2 and a molecular weight of 480.29 g/mol. Its IUPAC name is 1,2-bis[(4-bromophenyl)sulfanyl]-4,5-dimethylbenzene.
| Compound Name | 1,2-bis[(4-bromophenyl)sulfanyl]-4,5-dimethylbenzene |
|---|---|
| PubChem CID | 58715679 |
| Molecular Formula | C20H16Br2S2 |
| Molecular Weight | 480.29 g/mol |
| Exact Mass | 477.91 |
| IUPAC Name | 1,2-bis[(4-bromophenyl)sulfanyl]-4,5-dimethylbenzene |
| SMILES | Cc1cc(Sc2ccc(Br)cc2)c(Sc2ccc(Br)cc2)cc1C |
| InChI | InChI=1S/C20H16Br2S2/c1-13-11-19(23-17-7-3-15(21)4-8-17)20(12-14(13)2)24-18-9-5-16(22)6-10-18/h3-12H,1-2H3 |
| InChIKey | CWHNFJBMWYDADM-UHFFFAOYSA-N |
| XLogP | 8.13 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.29 |
| LogP ≤ 5 | 8.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |