C15H15ClS — CID 22947184
1-(4-chlorophenyl)sulfanyl-2,4,5-trimethylbenzene (PubChem CID 22947184) has the molecular formula C15H15ClS and a molecular weight of 262.81 g/mol. Its IUPAC name is 1-(4-chlorophenyl)sulfanyl-2,4,5-trimethylbenzene.
| Compound Name | 1-(4-chlorophenyl)sulfanyl-2,4,5-trimethylbenzene |
|---|---|
| PubChem CID | 22947184 |
| Molecular Formula | C15H15ClS |
| Molecular Weight | 262.81 g/mol |
| Exact Mass | 262.06 |
| IUPAC Name | 1-(4-chlorophenyl)sulfanyl-2,4,5-trimethylbenzene |
| SMILES | Cc1cc(C)c(Sc2ccc(Cl)cc2)cc1C |
| InChI | InChI=1S/C15H15ClS/c1-10-8-12(3)15(9-11(10)2)17-14-6-4-13(16)5-7-14/h4-9H,1-3H3 |
| InChIKey | ORBWLLNSULZLJP-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.81 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |