About 5-methoxy-3-(2-oxopropyl)-1,3,4-thiadiazol-2-one
5-methoxy-3-(2-oxopropyl)-1,3,4-thiadiazol-2-one (PubChem CID 19350724) has the molecular formula C6H8N2O3S
and a molecular weight of 188.21 g/mol. Its IUPAC name is 5-methoxy-3-(2-oxopropyl)-1,3,4-thiadiazol-2-one.
Molecular Properties
| Compound Name | 5-methoxy-3-(2-oxopropyl)-1,3,4-thiadiazol-2-one |
| PubChem CID | 19350724 |
| Molecular Formula | C6H8N2O3S |
| Molecular Weight | 188.21 g/mol |
| Exact Mass | 188.03 |
| IUPAC Name | 5-methoxy-3-(2-oxopropyl)-1,3,4-thiadiazol-2-one |
| SMILES | COc1nn(CC(C)=O)c(=O)s1 |
| InChI | InChI=1S/C6H8N2O3S/c1-4(9)3-8-6(10)12-5(7-8)11-2/h3H2,1-2H3 |
| InChIKey | FSNIHPFPRYJYHH-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.21 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-methoxy-3-(2-oxopropyl)-1,3,4-thiadiazol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methoxy-3-(2-oxopropyl)-1,3,4-thiadiazol-2-one?
The IUPAC name of 5-methoxy-3-(2-oxopropyl)-1,3,4-thiadiazol-2-one (CID 19350724) is 5-methoxy-3-(2-oxopropyl)-1,3,4-thiadiazol-2-one.
What is the SMILES notation for 5-methoxy-3-(2-oxopropyl)-1,3,4-thiadiazol-2-one?
The canonical SMILES for 5-methoxy-3-(2-oxopropyl)-1,3,4-thiadiazol-2-one is COc1nn(CC(C)=O)c(=O)s1.
What is the InChIKey of 5-methoxy-3-(2-oxopropyl)-1,3,4-thiadiazol-2-one?
The InChIKey is FSNIHPFPRYJYHH-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N2O3S/c1-4(9)3-8-6(10)12-5(7-8)11-2/h3H2,1-2H3.
What are the key properties of 5-methoxy-3-(2-oxopropyl)-1,3,4-thiadiazol-2-one?
5-methoxy-3-(2-oxopropyl)-1,3,4-thiadiazol-2-one has a molecular weight of 188.21 g/mol, XLogP of -0.10, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methoxy-3-(2-oxopropyl)-1,3,4-thiadiazol-2-one is sourced from PubChem (CID 19350724), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).