C20H25N4O3+ — CID 8590909
N-(2,4-dimethylphenyl)-2-[4-(4-nitrophenyl)piperazin-1-ium-1-yl]acetamide (PubChem CID 8590909) has the molecular formula C20H25N4O3+ and a molecular weight of 369.45 g/mol. Its IUPAC name is N-(2,4-dimethylphenyl)-2-[4-(4-nitrophenyl)piperazin-1-ium-1-yl]acetamide.
| Compound Name | N-(2,4-dimethylphenyl)-2-[4-(4-nitrophenyl)piperazin-1-ium-1-yl]acetamide |
|---|---|
| PubChem CID | 8590909 |
| Molecular Formula | C20H25N4O3+ |
| Molecular Weight | 369.45 g/mol |
| Exact Mass | 369.19 |
| IUPAC Name | N-(2,4-dimethylphenyl)-2-[4-(4-nitrophenyl)piperazin-1-ium-1-yl]acetamide |
| SMILES | Cc1ccc(NC(=O)C[NH+]2CCN(c3ccc([N+](=O)[O-])cc3)CC2)c(C)c1 |
| InChI | InChI=1S/C20H24N4O3/c1-15-3-8-19(16(2)13-15)21-20(25)14-22-9-11-23(12-10-22)17-4-6-18(7-5-17)24(26)27/h3-8,13H,9-12,14H2,1-2H3,(H,21,25)/p+1 |
| InChIKey | BAKARYIICKYUSQ-UHFFFAOYSA-O |
| XLogP | 1.56 |
| TPSA | 79.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.45 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|