C15H23N4O6+ — CID 7592313
(2R)-2-[2-(dimethylazaniumyl)ethylazaniumyl]-4-(2-methoxy-5-nitroanilino)-4-oxobutanoate (PubChem CID 7592313) has the molecular formula C15H23N4O6+ and a molecular weight of 355.37 g/mol. Its IUPAC name is (2R)-2-[2-(dimethylazaniumyl)ethylazaniumyl]-4-(2-methoxy-5-nitroanilino)-4-oxobutanoate.
| Compound Name | (2R)-2-[2-(dimethylazaniumyl)ethylazaniumyl]-4-(2-methoxy-5-nitroanilino)-4-oxobutanoate |
|---|---|
| PubChem CID | 7592313 |
| Molecular Formula | C15H23N4O6+ |
| Molecular Weight | 355.37 g/mol |
| Exact Mass | 355.16 |
| IUPAC Name | (2R)-2-[2-(dimethylazaniumyl)ethylazaniumyl]-4-(2-methoxy-5-nitroanilino)-4-oxobutanoate |
| SMILES | COc1ccc([N+](=O)[O-])cc1NC(=O)C[C@@H]([NH2+]CC[NH+](C)C)C(=O)[O-] |
| InChI | InChI=1S/C15H22N4O6/c1-18(2)7-6-16-12(15(21)22)9-14(20)17-11-8-10(19(23)24)4-5-13(11)25-3/h4-5,8,12,16H,6-7,9H2,1-3H3,(H,17,20)(H,21,22)/p+1/t12-/m1/s1 |
| InChIKey | FKKWTDFHURKNKV-GFCCVEGCSA-O |
| XLogP | -3.24 |
| TPSA | 142.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.37 |
| LogP ≤ 5 | -3.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|