C20H23N5O3S — CID 7592971
(2R)-4-oxo-4-[3-(prop-2-enylcarbamothioylamino)anilino]-2-(pyridin-3-ylmethylamino)butanoic acid (PubChem CID 7592971) has the molecular formula C20H23N5O3S and a molecular weight of 413.50 g/mol. Its IUPAC name is (2R)-4-oxo-4-[3-(prop-2-enylcarbamothioylamino)anilino]-2-(pyridin-3-ylmethylamino)butanoic acid.
| Compound Name | (2R)-4-oxo-4-[3-(prop-2-enylcarbamothioylamino)anilino]-2-(pyridin-3-ylmethylamino)butanoic acid |
|---|---|
| PubChem CID | 7592971 |
| Molecular Formula | C20H23N5O3S |
| Molecular Weight | 413.50 g/mol |
| Exact Mass | 413.15 |
| IUPAC Name | (2R)-4-oxo-4-[3-(prop-2-enylcarbamothioylamino)anilino]-2-(pyridin-3-ylmethylamino)butanoic acid |
| SMILES | C=CCNC(=S)Nc1cccc(NC(=O)C[C@@H](NCc2cccnc2)C(=O)O)c1 |
| InChI | InChI=1S/C20H23N5O3S/c1-2-8-22-20(29)25-16-7-3-6-15(10-16)24-18(26)11-17(19(27)28)23-13-14-5-4-9-21-12-14/h2-7,9-10,12,17,23H,1,8,11,13H2,(H,24,26)(H,27,28)(H2,22,25,29)/t17-/m1/s1 |
| InChIKey | BZXSWWJSAMSJBT-QGZVFWFLSA-N |
| XLogP | 2.13 |
| TPSA | 115.38 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.50 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|