C17H16F3N3O3 — CID 4860913
4-oxo-2-(pyridin-3-ylmethylamino)-4-[3-(trifluoromethyl)anilino]butanoic acid (PubChem CID 4860913) has the molecular formula C17H16F3N3O3 and a molecular weight of 367.33 g/mol. Its IUPAC name is 4-oxo-2-(pyridin-3-ylmethylamino)-4-[3-(trifluoromethyl)anilino]butanoic acid.
| Compound Name | 4-oxo-2-(pyridin-3-ylmethylamino)-4-[3-(trifluoromethyl)anilino]butanoic acid |
|---|---|
| PubChem CID | 4860913 |
| Molecular Formula | C17H16F3N3O3 |
| Molecular Weight | 367.33 g/mol |
| Exact Mass | 367.11 |
| IUPAC Name | 4-oxo-2-(pyridin-3-ylmethylamino)-4-[3-(trifluoromethyl)anilino]butanoic acid |
| SMILES | O=C(CC(NCc1cccnc1)C(=O)O)Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C17H16F3N3O3/c18-17(19,20)12-4-1-5-13(7-12)23-15(24)8-14(16(25)26)22-10-11-3-2-6-21-9-11/h1-7,9,14,22H,8,10H2,(H,23,24)(H,25,26) |
| InChIKey | FTIFDSXJJVLYDI-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 91.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.33 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |