C16H15F3N2O4 — CID 1297837
(2S)-2-(furan-2-ylmethylamino)-4-oxo-4-[3-(trifluoromethyl)anilino]butanoic acid (PubChem CID 1297837) has the molecular formula C16H15F3N2O4 and a molecular weight of 356.30 g/mol. Its IUPAC name is (2S)-2-(furan-2-ylmethylamino)-4-oxo-4-[3-(trifluoromethyl)anilino]butanoic acid.
| Compound Name | (2S)-2-(furan-2-ylmethylamino)-4-oxo-4-[3-(trifluoromethyl)anilino]butanoic acid |
|---|---|
| PubChem CID | 1297837 |
| Molecular Formula | C16H15F3N2O4 |
| Molecular Weight | 356.30 g/mol |
| Exact Mass | 356.10 |
| IUPAC Name | (2S)-2-(furan-2-ylmethylamino)-4-oxo-4-[3-(trifluoromethyl)anilino]butanoic acid |
| SMILES | O=C(C[C@H](NCc1ccco1)C(=O)O)Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C16H15F3N2O4/c17-16(18,19)10-3-1-4-11(7-10)21-14(22)8-13(15(23)24)20-9-12-5-2-6-25-12/h1-7,13,20H,8-9H2,(H,21,22)(H,23,24)/t13-/m0/s1 |
| InChIKey | QBVFPPZJKYXGGZ-ZDUSSCGKSA-N |
| XLogP | 2.87 |
| TPSA | 91.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.30 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |