C17H22N4O3S — CID 7593018
(2R)-4-oxo-2-(prop-2-enylamino)-4-[3-(prop-2-enylcarbamothioylamino)anilino]butanoic acid (PubChem CID 7593018) has the molecular formula C17H22N4O3S and a molecular weight of 362.46 g/mol. Its IUPAC name is (2R)-4-oxo-2-(prop-2-enylamino)-4-[3-(prop-2-enylcarbamothioylamino)anilino]butanoic acid.
| Compound Name | (2R)-4-oxo-2-(prop-2-enylamino)-4-[3-(prop-2-enylcarbamothioylamino)anilino]butanoic acid |
|---|---|
| PubChem CID | 7593018 |
| Molecular Formula | C17H22N4O3S |
| Molecular Weight | 362.46 g/mol |
| Exact Mass | 362.14 |
| IUPAC Name | (2R)-4-oxo-2-(prop-2-enylamino)-4-[3-(prop-2-enylcarbamothioylamino)anilino]butanoic acid |
| SMILES | C=CCNC(=S)Nc1cccc(NC(=O)C[C@@H](NCC=C)C(=O)O)c1 |
| InChI | InChI=1S/C17H22N4O3S/c1-3-8-18-14(16(23)24)11-15(22)20-12-6-5-7-13(10-12)21-17(25)19-9-4-2/h3-7,10,14,18H,1-2,8-9,11H2,(H,20,22)(H,23,24)(H2,19,21,25)/t14-/m1/s1 |
| InChIKey | FFZVIGXWYMHJCO-CQSZACIVSA-N |
| XLogP | 1.72 |
| TPSA | 102.49 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.46 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|