C15H22N2O5 — CID 7591939
(2S)-4-(2,4-dimethoxyanilino)-4-oxo-2-(propylazaniumyl)butanoate (PubChem CID 7591939) has the molecular formula C15H22N2O5 and a molecular weight of 310.35 g/mol. Its IUPAC name is (2S)-4-(2,4-dimethoxyanilino)-4-oxo-2-(propylazaniumyl)butanoate.
| Compound Name | (2S)-4-(2,4-dimethoxyanilino)-4-oxo-2-(propylazaniumyl)butanoate |
|---|---|
| PubChem CID | 7591939 |
| Molecular Formula | C15H22N2O5 |
| Molecular Weight | 310.35 g/mol |
| Exact Mass | 310.15 |
| IUPAC Name | (2S)-4-(2,4-dimethoxyanilino)-4-oxo-2-(propylazaniumyl)butanoate |
| SMILES | CCC[NH2+][C@@H](CC(=O)Nc1ccc(OC)cc1OC)C(=O)[O-] |
| InChI | InChI=1S/C15H22N2O5/c1-4-7-16-12(15(19)20)9-14(18)17-11-6-5-10(21-2)8-13(11)22-3/h5-6,8,12,16H,4,7,9H2,1-3H3,(H,17,18)(H,19,20)/t12-/m0/s1 |
| InChIKey | JVRBXTLKIYKQTM-LBPRGKRZSA-N |
| XLogP | -0.88 |
| TPSA | 104.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.35 |
| LogP ≤ 5 | -0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |